3,3'-Diaminobenzidine
| Use attributes for filter ! | |
| Formula | C12H14N4C12H18Cl4N4(4HCl) |
|---|---|
| Molar mass | 214. 27 g/mol |
| GHS hazard statements | H341, H350 |
| NFPA 704 (fire diamond) | 1 2 2 |
| GHS Signal word | Danger |
| UN number | 2811 |
| Date of Reg. | |
| Date of Upd. | |
| ID | 3116592 |
About 3,3'-Diaminobenzidine
3,3'-Diaminobenzidine is an organic compound with the formula (C₆H₃(NH₂)₂)₂. This derivative of benzidine is a precursor to polybenzimidazole, which forms fibers that are renowned for their chemical and thermal stability.
3,3'-Diaminobenzidine Photos
